ChemNet > CAS > 43020-12-8 1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one
43020-12-8 1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one
| product Name |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one |
| CAS No |
43020-12-8 |
| Synonyms |
1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
| Molecular Formula |
C13H11ClO2 |
| Molecular Weight |
234.6782 |
| InChI |
InChI=1/C13H11ClO2/c1-8(15)12-7-13(16-9(12)2)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
| Molecular Structure |
![43020-12-8 1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one](https://images-a.chemnet.com/suppliers/chembase/cas11/cas43020-12-8.gif)
|
| Density |
1.189g/cm3 |
| Melting point |
114℃ |
| Boiling point |
346.1°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
163.1°C |
| Vapour Pressur |
5.88E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
